C14H20F2N4S — CID 118885070
(4S,5S,6S)-4-(5-amino-2,3-difluorophenyl)-6-(aminomethyl)-4,5,6-trimethyl-5H-1,3-thiazin-2-amine (PubChem CID 118885070) has the molecular formula C14H20F2N4S and a molecular weight of 314.41 g/mol. Its IUPAC name is (4S,5S,6S)-4-(5-amino-2,3-difluorophenyl)-6-(aminomethyl)-4,5,6-trimethyl-5H-1,3-thiazin-2-amine.
| Compound Name | (4S,5S,6S)-4-(5-amino-2,3-difluorophenyl)-6-(aminomethyl)-4,5,6-trimethyl-5H-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 118885070 |
| Molecular Formula | C14H20F2N4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | (4S,5S,6S)-4-(5-amino-2,3-difluorophenyl)-6-(aminomethyl)-4,5,6-trimethyl-5H-1,3-thiazin-2-amine |
| SMILES | C[C@@H]1[C@@](C)(CN)SC(N)=N[C@]1(C)c1cc(N)cc(F)c1F |
| InChI | InChI=1S/C14H20F2N4S/c1-7-13(2,6-17)21-12(19)20-14(7,3)9-4-8(18)5-10(15)11(9)16/h4-5,7H,6,17-18H2,1-3H3,(H2,19,20)/t7-,13-,14+/m1/s1 |
| InChIKey | AHGPMEWEDRGWMF-FNSHAYQCSA-N |
| XLogP | 2.18 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|