C21H20ClF2N5OS — CID 126557648
(1S,5S,6S,7S)-3-amino-5-[5-[(Z)-2-(5-chloropyrazin-2-yl)-2-fluoroethenyl]-2-fluorophenyl]-N,5,7-trimethyl-2-thia-4-azabicyclo[4.1.0]hept-3-ene-1-carboxamide (PubChem CID 126557648) has the molecular formula C21H20ClF2N5OS and a molecular weight of 463.94 g/mol. Its IUPAC name is (1S,5S,6S,7S)-3-amino-5-[5-[(Z)-2-(5-chloropyrazin-2-yl)-2-fluoroethenyl]-2-fluorophenyl]-N,5,7-trimethyl-2-thia-4-azabicyclo[4.1.0]hept-3-ene-1-carboxamide.
| Compound Name | (1S,5S,6S,7S)-3-amino-5-[5-[(Z)-2-(5-chloropyrazin-2-yl)-2-fluoroethenyl]-2-fluorophenyl]-N,5,7-trimethyl-2-thia-4-azabicyclo[4.1.0]hept-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 126557648 |
| Molecular Formula | C21H20ClF2N5OS |
| Molecular Weight | 463.94 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | (1S,5S,6S,7S)-3-amino-5-[5-[(Z)-2-(5-chloropyrazin-2-yl)-2-fluoroethenyl]-2-fluorophenyl]-N,5,7-trimethyl-2-thia-4-azabicyclo[4.1.0]hept-3-ene-1-carboxamide |
| SMILES | CNC(=O)[C@@]12SC(N)=N[C@](C)(c3cc(/C=C(\F)c4cnc(Cl)cn4)ccc3F)[C@@H]1[C@@H]2C |
| InChI | InChI=1S/C21H20ClF2N5OS/c1-10-17-20(2,29-19(25)31-21(10,17)18(30)26-3)12-6-11(4-5-13(12)23)7-14(24)15-8-28-16(22)9-27-15/h4-10,17H,1-3H3,(H2,25,29)(H,26,30)/b14-7-/t10-,17-,20+,21-/m0/s1 |
| InChIKey | HGDSBOFNPPQAPP-DYEZGZMASA-N |
| XLogP | 3.76 |
| TPSA | 93.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.94 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |