C19H17BrClN3O3S — CID 86658495
tert-butyl N-[(4S)-7'-bromo-3'-chlorospiro[5H-1,3-thiazole-4,5'-chromeno[2,3-c]pyridine]-2-yl]carbamate (PubChem CID 86658495) has the molecular formula C19H17BrClN3O3S and a molecular weight of 482.79 g/mol. Its IUPAC name is tert-butyl N-[(4S)-7'-bromo-3'-chlorospiro[5H-1,3-thiazole-4,5'-chromeno[2,3-c]pyridine]-2-yl]carbamate.
| Compound Name | tert-butyl N-[(4S)-7'-bromo-3'-chlorospiro[5H-1,3-thiazole-4,5'-chromeno[2,3-c]pyridine]-2-yl]carbamate |
|---|---|
| PubChem CID | 86658495 |
| Molecular Formula | C19H17BrClN3O3S |
| Molecular Weight | 482.79 g/mol |
| Exact Mass | 480.99 |
| IUPAC Name | tert-butyl N-[(4S)-7'-bromo-3'-chlorospiro[5H-1,3-thiazole-4,5'-chromeno[2,3-c]pyridine]-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1=N[C@@]2(CS1)c1cc(Br)ccc1Oc1cnc(Cl)cc12 |
| InChI | InChI=1S/C19H17BrClN3O3S/c1-18(2,3)27-17(25)23-16-24-19(9-28-16)11-6-10(20)4-5-13(11)26-14-8-22-15(21)7-12(14)19/h4-8H,9H2,1-3H3,(H,23,24,25)/t19-/m0/s1 |
| InChIKey | AFACSSYPRLKZGW-IBGZPJMESA-N |
| XLogP | 5.47 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.79 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|