C26H31BrN4O3S — CID 66689574
tert-butyl N-[6-[(5-bromopyridine-2-carbonyl)amino]-2,2-dimethylspiro[1,3-dihydronaphthalene-4,4'-5,6-dihydro-1,3-thiazine]-2'-yl]carbamate (PubChem CID 66689574) has the molecular formula C26H31BrN4O3S and a molecular weight of 559.53 g/mol. Its IUPAC name is tert-butyl N-[6-[(5-bromopyridine-2-carbonyl)amino]-2,2-dimethylspiro[1,3-dihydronaphthalene-4,4'-5,6-dihydro-1,3-thiazine]-2'-yl]carbamate.
| Compound Name | tert-butyl N-[6-[(5-bromopyridine-2-carbonyl)amino]-2,2-dimethylspiro[1,3-dihydronaphthalene-4,4'-5,6-dihydro-1,3-thiazine]-2'-yl]carbamate |
|---|---|
| PubChem CID | 66689574 |
| Molecular Formula | C26H31BrN4O3S |
| Molecular Weight | 559.53 g/mol |
| Exact Mass | 558.13 |
| IUPAC Name | tert-butyl N-[6-[(5-bromopyridine-2-carbonyl)amino]-2,2-dimethylspiro[1,3-dihydronaphthalene-4,4'-5,6-dihydro-1,3-thiazine]-2'-yl]carbamate |
| SMILES | CC1(C)Cc2ccc(NC(=O)c3ccc(Br)cn3)cc2C2(CCSC(NC(=O)OC(C)(C)C)=N2)C1 |
| InChI | InChI=1S/C26H31BrN4O3S/c1-24(2,3)34-23(33)30-22-31-26(10-11-35-22)15-25(4,5)13-16-6-8-18(12-19(16)26)29-21(32)20-9-7-17(27)14-28-20/h6-9,12,14H,10-11,13,15H2,1-5H3,(H,29,32)(H,30,31,33) |
| InChIKey | VJYDCECQAYVBIT-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.53 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |