C25H32N4O4S — CID 66688377
tert-butyl N-[2,2-dimethyl-6-[(2-methyl-1,3-oxazole-4-carbonyl)amino]spiro[1,3-dihydronaphthalene-4,4'-5,6-dihydro-1,3-thiazine]-2'-yl]carbamate (PubChem CID 66688377) has the molecular formula C25H32N4O4S and a molecular weight of 484.62 g/mol. Its IUPAC name is tert-butyl N-[2,2-dimethyl-6-[(2-methyl-1,3-oxazole-4-carbonyl)amino]spiro[1,3-dihydronaphthalene-4,4'-5,6-dihydro-1,3-thiazine]-2'-yl]carbamate.
| Compound Name | tert-butyl N-[2,2-dimethyl-6-[(2-methyl-1,3-oxazole-4-carbonyl)amino]spiro[1,3-dihydronaphthalene-4,4'-5,6-dihydro-1,3-thiazine]-2'-yl]carbamate |
|---|---|
| PubChem CID | 66688377 |
| Molecular Formula | C25H32N4O4S |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | tert-butyl N-[2,2-dimethyl-6-[(2-methyl-1,3-oxazole-4-carbonyl)amino]spiro[1,3-dihydronaphthalene-4,4'-5,6-dihydro-1,3-thiazine]-2'-yl]carbamate |
| SMILES | Cc1nc(C(=O)Nc2ccc3c(c2)C2(CCSC(NC(=O)OC(C)(C)C)=N2)CC(C)(C)C3)co1 |
| InChI | InChI=1S/C25H32N4O4S/c1-15-26-19(13-32-15)20(30)27-17-8-7-16-12-24(5,6)14-25(18(16)11-17)9-10-34-21(29-25)28-22(31)33-23(2,3)4/h7-8,11,13H,9-10,12,14H2,1-6H3,(H,27,30)(H,28,29,31) |
| InChIKey | QZMTZJTZLQMWJN-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |