C15H11BrClN3O — CID 141263181
(3S)-7'-bromo-3'-chlorospiro[1,2-dihydropyrrole-3,5'-chromeno[2,3-c]pyridine]-5-amine (PubChem CID 141263181) has the molecular formula C15H11BrClN3O and a molecular weight of 364.63 g/mol. Its IUPAC name is (3S)-7'-bromo-3'-chlorospiro[1,2-dihydropyrrole-3,5'-chromeno[2,3-c]pyridine]-5-amine.
| Compound Name | (3S)-7'-bromo-3'-chlorospiro[1,2-dihydropyrrole-3,5'-chromeno[2,3-c]pyridine]-5-amine |
|---|---|
| PubChem CID | 141263181 |
| Molecular Formula | C15H11BrClN3O |
| Molecular Weight | 364.63 g/mol |
| Exact Mass | 362.98 |
| IUPAC Name | (3S)-7'-bromo-3'-chlorospiro[1,2-dihydropyrrole-3,5'-chromeno[2,3-c]pyridine]-5-amine |
| SMILES | NC1=C[C@]2(CN1)c1cc(Br)ccc1Oc1cnc(Cl)cc12 |
| InChI | InChI=1S/C15H11BrClN3O/c16-8-1-2-11-9(3-8)15(5-14(18)20-7-15)10-4-13(17)19-6-12(10)21-11/h1-6,20H,7,18H2/t15-/m0/s1 |
| InChIKey | XUOMBZVOQAKFPG-HNNXBMFYSA-N |
| XLogP | 3.29 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.63 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|