C17H15BrN2O2 — CID 141263164
(3S)-2'-bromo-7'-methoxyspiro[1,2-dihydropyrrole-3,9'-xanthene]-5-amine (PubChem CID 141263164) has the molecular formula C17H15BrN2O2 and a molecular weight of 359.22 g/mol. Its IUPAC name is (3S)-2'-bromo-7'-methoxyspiro[1,2-dihydropyrrole-3,9'-xanthene]-5-amine.
| Compound Name | (3S)-2'-bromo-7'-methoxyspiro[1,2-dihydropyrrole-3,9'-xanthene]-5-amine |
|---|---|
| PubChem CID | 141263164 |
| Molecular Formula | C17H15BrN2O2 |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | (3S)-2'-bromo-7'-methoxyspiro[1,2-dihydropyrrole-3,9'-xanthene]-5-amine |
| SMILES | COc1ccc2c(c1)[C@@]1(C=C(N)NC1)c1cc(Br)ccc1O2 |
| InChI | InChI=1S/C17H15BrN2O2/c1-21-11-3-5-15-13(7-11)17(8-16(19)20-9-17)12-6-10(18)2-4-14(12)22-15/h2-8,20H,9,19H2,1H3/t17-/m1/s1 |
| InChIKey | HISJDQJWIBAKEN-QGZVFWFLSA-N |
| XLogP | 3.25 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |