C17H13BrFNO4 — CID 77292419
2'-bromo-4'-fluoro-7'-methoxyspiro[morpholine-5,9'-xanthene]-3-one (PubChem CID 77292419) has the molecular formula C17H13BrFNO4 and a molecular weight of 394.20 g/mol. Its IUPAC name is 2'-bromo-4'-fluoro-7'-methoxyspiro[morpholine-5,9'-xanthene]-3-one.
| Compound Name | 2'-bromo-4'-fluoro-7'-methoxyspiro[morpholine-5,9'-xanthene]-3-one |
|---|---|
| PubChem CID | 77292419 |
| Molecular Formula | C17H13BrFNO4 |
| Molecular Weight | 394.20 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | 2'-bromo-4'-fluoro-7'-methoxyspiro[morpholine-5,9'-xanthene]-3-one |
| SMILES | COc1ccc2c(c1)C1(COCC(=O)N1)c1cc(Br)cc(F)c1O2 |
| InChI | InChI=1S/C17H13BrFNO4/c1-22-10-2-3-14-11(6-10)17(8-23-7-15(21)20-17)12-4-9(18)5-13(19)16(12)24-14/h2-6H,7-8H2,1H3,(H,20,21) |
| InChIKey | JTCXHLIBZSWGIP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.20 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |