C12H14N2O3 — CID 70585209
6-methoxyspiro[2,3-dihydrochromene-4,5'-imidazolidine]-4'-one (PubChem CID 70585209) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is 6-methoxyspiro[2,3-dihydrochromene-4,5'-imidazolidine]-4'-one.
| Compound Name | 6-methoxyspiro[2,3-dihydrochromene-4,5'-imidazolidine]-4'-one |
|---|---|
| PubChem CID | 70585209 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 6-methoxyspiro[2,3-dihydrochromene-4,5'-imidazolidine]-4'-one |
| SMILES | COc1ccc2c(c1)C1(CCO2)NCNC1=O |
| InChI | InChI=1S/C12H14N2O3/c1-16-8-2-3-10-9(6-8)12(4-5-17-10)11(15)13-7-14-12/h2-3,6,14H,4-5,7H2,1H3,(H,13,15) |
| InChIKey | IBQHWRRFPAUANN-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |