C16H12BrIN2O — CID 141263231
(3S)-2'-bromo-7'-iodospiro[1,2-dihydropyrrole-3,9'-xanthene]-5-amine (PubChem CID 141263231) has the molecular formula C16H12BrIN2O and a molecular weight of 455.09 g/mol. Its IUPAC name is (3S)-2'-bromo-7'-iodospiro[1,2-dihydropyrrole-3,9'-xanthene]-5-amine.
| Compound Name | (3S)-2'-bromo-7'-iodospiro[1,2-dihydropyrrole-3,9'-xanthene]-5-amine |
|---|---|
| PubChem CID | 141263231 |
| Molecular Formula | C16H12BrIN2O |
| Molecular Weight | 455.09 g/mol |
| Exact Mass | 453.92 |
| IUPAC Name | (3S)-2'-bromo-7'-iodospiro[1,2-dihydropyrrole-3,9'-xanthene]-5-amine |
| SMILES | NC1=C[C@]2(CN1)c1cc(Br)ccc1Oc1ccc(I)cc12 |
| InChI | InChI=1S/C16H12BrIN2O/c17-9-1-3-13-11(5-9)16(7-15(19)20-8-16)12-6-10(18)2-4-14(12)21-13/h1-7,20H,8,19H2/t16-/m0/s1 |
| InChIKey | UPWWROKMINAJTP-INIZCTEOSA-N |
| XLogP | 3.85 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.09 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|