C15H11BrIN3OS — CID 67437973
3'-bromo-7'-iodospiro[5,6-dihydro-1,3-thiazine-4,5'-chromeno[2,3-b]pyridine]-2-amine (PubChem CID 67437973) has the molecular formula C15H11BrIN3OS and a molecular weight of 488.15 g/mol. Its IUPAC name is 3'-bromo-7'-iodospiro[5,6-dihydro-1,3-thiazine-4,5'-chromeno[2,3-b]pyridine]-2-amine.
| Compound Name | 3'-bromo-7'-iodospiro[5,6-dihydro-1,3-thiazine-4,5'-chromeno[2,3-b]pyridine]-2-amine |
|---|---|
| PubChem CID | 67437973 |
| Molecular Formula | C15H11BrIN3OS |
| Molecular Weight | 488.15 g/mol |
| Exact Mass | 486.89 |
| IUPAC Name | 3'-bromo-7'-iodospiro[5,6-dihydro-1,3-thiazine-4,5'-chromeno[2,3-b]pyridine]-2-amine |
| SMILES | NC1=NC2(CCS1)c1cc(I)ccc1Oc1ncc(Br)cc12 |
| InChI | InChI=1S/C15H11BrIN3OS/c16-8-5-11-13(19-7-8)21-12-2-1-9(17)6-10(12)15(11)3-4-22-14(18)20-15/h1-2,5-7H,3-4H2,(H2,18,20) |
| InChIKey | TZHJQMYBHYYPTC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.15 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|