C14H9BrFN3O2 — CID 67383035
7'-bromo-2'-fluorospiro[5H-1,3-oxazole-4,5'-chromeno[2,3-b]pyridine]-2-amine (PubChem CID 67383035) has the molecular formula C14H9BrFN3O2 and a molecular weight of 350.15 g/mol. Its IUPAC name is 7'-bromo-2'-fluorospiro[5H-1,3-oxazole-4,5'-chromeno[2,3-b]pyridine]-2-amine.
| Compound Name | 7'-bromo-2'-fluorospiro[5H-1,3-oxazole-4,5'-chromeno[2,3-b]pyridine]-2-amine |
|---|---|
| PubChem CID | 67383035 |
| Molecular Formula | C14H9BrFN3O2 |
| Molecular Weight | 350.15 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | 7'-bromo-2'-fluorospiro[5H-1,3-oxazole-4,5'-chromeno[2,3-b]pyridine]-2-amine |
| SMILES | NC1=NC2(CO1)c1cc(Br)ccc1Oc1nc(F)ccc12 |
| InChI | InChI=1S/C14H9BrFN3O2/c15-7-1-3-10-9(5-7)14(6-20-13(17)19-14)8-2-4-11(16)18-12(8)21-10/h1-5H,6H2,(H2,17,19) |
| InChIKey | WVELVCIOOGEVSP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.15 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|