C19H11F2IN4O2 — CID 58466183
2'-fluoro-7'-(2-fluoro-3-pyridinyl)-3'-iodospiro[5H-1,3-oxazole-4,5'-chromeno[2,3-b]pyridine]-2-amine (PubChem CID 58466183) has the molecular formula C19H11F2IN4O2 and a molecular weight of 492.22 g/mol. Its IUPAC name is 2'-fluoro-7'-(2-fluoro-3-pyridinyl)-3'-iodospiro[5H-1,3-oxazole-4,5'-chromeno[2,3-b]pyridine]-2-amine.
| Compound Name | 2'-fluoro-7'-(2-fluoro-3-pyridinyl)-3'-iodospiro[5H-1,3-oxazole-4,5'-chromeno[2,3-b]pyridine]-2-amine |
|---|---|
| PubChem CID | 58466183 |
| Molecular Formula | C19H11F2IN4O2 |
| Molecular Weight | 492.22 g/mol |
| Exact Mass | 491.99 |
| IUPAC Name | 2'-fluoro-7'-(2-fluoro-3-pyridinyl)-3'-iodospiro[5H-1,3-oxazole-4,5'-chromeno[2,3-b]pyridine]-2-amine |
| SMILES | NC1=NC2(CO1)c1cc(-c3cccnc3F)ccc1Oc1nc(F)c(I)cc12 |
| InChI | InChI=1S/C19H11F2IN4O2/c20-15-10(2-1-5-24-15)9-3-4-14-11(6-9)19(8-27-18(23)26-19)12-7-13(22)16(21)25-17(12)28-14/h1-7H,8H2,(H2,23,26) |
| InChIKey | GDTQAUVJUYFFOH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.22 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|