C23H17ClF3N3O5 — CID 87503805
2'-(2-chloro-3-pyridinyl)-7'-methoxyspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine;2,2,2-trifluoroacetic acid (PubChem CID 87503805) has the molecular formula C23H17ClF3N3O5 and a molecular weight of 507.85 g/mol. Its IUPAC name is 2'-(2-chloro-3-pyridinyl)-7'-methoxyspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 2'-(2-chloro-3-pyridinyl)-7'-methoxyspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87503805 |
| Molecular Formula | C23H17ClF3N3O5 |
| Molecular Weight | 507.85 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | 2'-(2-chloro-3-pyridinyl)-7'-methoxyspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc2c(c1)C1(COC(N)=N1)c1cc(-c3cccnc3Cl)ccc1O2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H16ClN3O3.C2HF3O2/c1-26-13-5-7-18-16(10-13)21(11-27-20(23)25-21)15-9-12(4-6-17(15)28-18)14-3-2-8-24-19(14)22;3-2(4,5)1(6)7/h2-10H,11H2,1H3,(H2,23,25);(H,6,7) |
| InChIKey | XKJGCJQWRXTQJA-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 116.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.85 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|