C15H11BrClNO2 — CID 86761963
7-bromo-3-chloro-5-prop-1-en-2-ylchromeno[2,3-c]pyridin-5-ol (PubChem CID 86761963) has the molecular formula C15H11BrClNO2 and a molecular weight of 352.62 g/mol. Its IUPAC name is 7-bromo-3-chloro-5-prop-1-en-2-ylchromeno[2,3-c]pyridin-5-ol.
| Compound Name | 7-bromo-3-chloro-5-prop-1-en-2-ylchromeno[2,3-c]pyridin-5-ol |
|---|---|
| PubChem CID | 86761963 |
| Molecular Formula | C15H11BrClNO2 |
| Molecular Weight | 352.62 g/mol |
| Exact Mass | 350.97 |
| IUPAC Name | 7-bromo-3-chloro-5-prop-1-en-2-ylchromeno[2,3-c]pyridin-5-ol |
| SMILES | C=C(C)C1(O)c2cc(Br)ccc2Oc2cnc(Cl)cc21 |
| InChI | InChI=1S/C15H11BrClNO2/c1-8(2)15(19)10-5-9(16)3-4-12(10)20-13-7-18-14(17)6-11(13)15/h3-7,19H,1H2,2H3 |
| InChIKey | HMFAQXZFISLMQK-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.62 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|