C19H21F2N3O7S — CID 59281222
tert-butyl N-[(4aR,8aS)-8a-(2,2-difluoro-6-nitro-1,3-benzodioxol-4-yl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]carbamate (PubChem CID 59281222) has the molecular formula C19H21F2N3O7S and a molecular weight of 473.45 g/mol. Its IUPAC name is tert-butyl N-[(4aR,8aS)-8a-(2,2-difluoro-6-nitro-1,3-benzodioxol-4-yl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]carbamate.
| Compound Name | tert-butyl N-[(4aR,8aS)-8a-(2,2-difluoro-6-nitro-1,3-benzodioxol-4-yl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]carbamate |
|---|---|
| PubChem CID | 59281222 |
| Molecular Formula | C19H21F2N3O7S |
| Molecular Weight | 473.45 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | tert-butyl N-[(4aR,8aS)-8a-(2,2-difluoro-6-nitro-1,3-benzodioxol-4-yl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1=N[C@@]2(c3cc([N+](=O)[O-])cc4c3OC(F)(F)O4)COCC[C@H]2CS1 |
| InChI | InChI=1S/C19H21F2N3O7S/c1-17(2,3)31-16(25)22-15-23-18(9-28-5-4-10(18)8-32-15)12-6-11(24(26)27)7-13-14(12)30-19(20,21)29-13/h6-7,10H,4-5,8-9H2,1-3H3,(H,22,23,25)/t10-,18-/m0/s1 |
| InChIKey | VURFKYIWAPQKHP-YPMLDQLKSA-N |
| XLogP | 3.78 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|