C13H13FIN5 — CID 67984343
6-(5-amino-2-fluorophenyl)-2-iodo-6-methyl-5H-imidazo[1,2-a]pyrazin-8-amine (PubChem CID 67984343) has the molecular formula C13H13FIN5 and a molecular weight of 385.18 g/mol. Its IUPAC name is 6-(5-amino-2-fluorophenyl)-2-iodo-6-methyl-5H-imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | 6-(5-amino-2-fluorophenyl)-2-iodo-6-methyl-5H-imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 67984343 |
| Molecular Formula | C13H13FIN5 |
| Molecular Weight | 385.18 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | 6-(5-amino-2-fluorophenyl)-2-iodo-6-methyl-5H-imidazo[1,2-a]pyrazin-8-amine |
| SMILES | CC1(c2cc(N)ccc2F)Cn2cc(I)nc2C(N)=N1 |
| InChI | InChI=1S/C13H13FIN5/c1-13(8-4-7(16)2-3-9(8)14)6-20-5-10(15)18-12(20)11(17)19-13/h2-5H,6,16H2,1H3,(H2,17,19) |
| InChIKey | ZPYNALZKXCPYRE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 82.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.18 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|