C15H13FN6O2 — CID 67981031
[6-(5-amino-2-fluorophenyl)-3-cyano-6-methyl-5H-imidazo[1,2-a]pyrazin-8-yl]carbamic acid (PubChem CID 67981031) has the molecular formula C15H13FN6O2 and a molecular weight of 328.31 g/mol. Its IUPAC name is [6-(5-amino-2-fluorophenyl)-3-cyano-6-methyl-5H-imidazo[1,2-a]pyrazin-8-yl]carbamic acid.
| Compound Name | [6-(5-amino-2-fluorophenyl)-3-cyano-6-methyl-5H-imidazo[1,2-a]pyrazin-8-yl]carbamic acid |
|---|---|
| PubChem CID | 67981031 |
| Molecular Formula | C15H13FN6O2 |
| Molecular Weight | 328.31 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | [6-(5-amino-2-fluorophenyl)-3-cyano-6-methyl-5H-imidazo[1,2-a]pyrazin-8-yl]carbamic acid |
| SMILES | CC1(c2cc(N)ccc2F)Cn2c(C#N)cnc2C(NC(=O)O)=N1 |
| InChI | InChI=1S/C15H13FN6O2/c1-15(10-4-8(18)2-3-11(10)16)7-22-9(5-17)6-19-13(22)12(21-15)20-14(23)24/h2-4,6H,7,18H2,1H3,(H,20,21)(H,23,24) |
| InChIKey | WLZFEIUDKVRHDS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 129.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|