C15H19BrFN3O4S — CID 118173070
[4-(5-bromo-2-fluorophenyl)-2,4,7,7-tetramethyl-1,1-dioxo-3H-1,2,5-thiadiazepin-6-yl]carbamic acid (PubChem CID 118173070) has the molecular formula C15H19BrFN3O4S and a molecular weight of 436.30 g/mol. Its IUPAC name is [4-(5-bromo-2-fluorophenyl)-2,4,7,7-tetramethyl-1,1-dioxo-3H-1,2,5-thiadiazepin-6-yl]carbamic acid.
| Compound Name | [4-(5-bromo-2-fluorophenyl)-2,4,7,7-tetramethyl-1,1-dioxo-3H-1,2,5-thiadiazepin-6-yl]carbamic acid |
|---|---|
| PubChem CID | 118173070 |
| Molecular Formula | C15H19BrFN3O4S |
| Molecular Weight | 436.30 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | [4-(5-bromo-2-fluorophenyl)-2,4,7,7-tetramethyl-1,1-dioxo-3H-1,2,5-thiadiazepin-6-yl]carbamic acid |
| SMILES | CN1CC(C)(c2cc(Br)ccc2F)N=C(NC(=O)O)C(C)(C)S1(=O)=O |
| InChI | InChI=1S/C15H19BrFN3O4S/c1-14(2)12(18-13(21)22)19-15(3,8-20(4)25(14,23)24)10-7-9(16)5-6-11(10)17/h5-7H,8H2,1-4H3,(H,18,19)(H,21,22) |
| InChIKey | FMYAIMKRKBLWTE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |