C19H24FN5O4S — CID 123752471
N-[3-(6-amino-2,4,7,7-tetramethyl-1,1-dioxo-3H-1,2,5-thiadiazepin-4-yl)-4-fluorophenyl]-3-methyl-1,2-oxazole-5-carboxamide (PubChem CID 123752471) has the molecular formula C19H24FN5O4S and a molecular weight of 437.50 g/mol. Its IUPAC name is N-[3-(6-amino-2,4,7,7-tetramethyl-1,1-dioxo-3H-1,2,5-thiadiazepin-4-yl)-4-fluorophenyl]-3-methyl-1,2-oxazole-5-carboxamide.
| Compound Name | N-[3-(6-amino-2,4,7,7-tetramethyl-1,1-dioxo-3H-1,2,5-thiadiazepin-4-yl)-4-fluorophenyl]-3-methyl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 123752471 |
| Molecular Formula | C19H24FN5O4S |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | N-[3-(6-amino-2,4,7,7-tetramethyl-1,1-dioxo-3H-1,2,5-thiadiazepin-4-yl)-4-fluorophenyl]-3-methyl-1,2-oxazole-5-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(F)c(C3(C)CN(C)S(=O)(=O)C(C)(C)C(N)=N3)c2)on1 |
| InChI | InChI=1S/C19H24FN5O4S/c1-11-8-15(29-24-11)16(26)22-12-6-7-14(20)13(9-12)19(4)10-25(5)30(27,28)18(2,3)17(21)23-19/h6-9H,10H2,1-5H3,(H2,21,23)(H,22,26) |
| InChIKey | CCRXEAANBZZELD-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 130.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |