C18H17F3N4O2 — CID 126595528
N-[(2R,5R)-6-amino-3,3,5-trifluoro-5-methylspiro[4H-pyridine-2,8'-bicyclo[4.2.0]octa-1(6),2,4-triene]-3'-yl]-3-methyl-1,2-oxazole-5-carboxamide (PubChem CID 126595528) has the molecular formula C18H17F3N4O2 and a molecular weight of 378.35 g/mol. Its IUPAC name is N-[(2R,5R)-6-amino-3,3,5-trifluoro-5-methylspiro[4H-pyridine-2,8'-bicyclo[4.2.0]octa-1(6),2,4-triene]-3'-yl]-3-methyl-1,2-oxazole-5-carboxamide.
| Compound Name | N-[(2R,5R)-6-amino-3,3,5-trifluoro-5-methylspiro[4H-pyridine-2,8'-bicyclo[4.2.0]octa-1(6),2,4-triene]-3'-yl]-3-methyl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 126595528 |
| Molecular Formula | C18H17F3N4O2 |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | N-[(2R,5R)-6-amino-3,3,5-trifluoro-5-methylspiro[4H-pyridine-2,8'-bicyclo[4.2.0]octa-1(6),2,4-triene]-3'-yl]-3-methyl-1,2-oxazole-5-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc3c(c2)[C@@]2(C3)N=C(N)[C@](C)(F)CC2(F)F)on1 |
| InChI | InChI=1S/C18H17F3N4O2/c1-9-5-13(27-25-9)14(26)23-11-4-3-10-7-17(12(10)6-11)18(20,21)8-16(2,19)15(22)24-17/h3-6H,7-8H2,1-2H3,(H2,22,24)(H,23,26)/t16-,17-/m1/s1 |
| InChIKey | YNICXFMJOFFCKB-IAGOWNOFSA-N |
| XLogP | 3.11 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |