C16H23F3N4O3S — CID 146531072
1-[3-[(4R)-6-amino-2,4,7,7-tetramethyl-1,1-dioxo-3H-1,2,5-thiadiazepin-4-yl]-4-fluoroanilino]-2,2-difluoroethanol (PubChem CID 146531072) has the molecular formula C16H23F3N4O3S and a molecular weight of 408.45 g/mol. Its IUPAC name is 1-[3-[(4R)-6-amino-2,4,7,7-tetramethyl-1,1-dioxo-3H-1,2,5-thiadiazepin-4-yl]-4-fluoroanilino]-2,2-difluoroethanol.
| Compound Name | 1-[3-[(4R)-6-amino-2,4,7,7-tetramethyl-1,1-dioxo-3H-1,2,5-thiadiazepin-4-yl]-4-fluoroanilino]-2,2-difluoroethanol |
|---|---|
| PubChem CID | 146531072 |
| Molecular Formula | C16H23F3N4O3S |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 1-[3-[(4R)-6-amino-2,4,7,7-tetramethyl-1,1-dioxo-3H-1,2,5-thiadiazepin-4-yl]-4-fluoroanilino]-2,2-difluoroethanol |
| SMILES | CN1C[C@@](C)(c2cc(NC(O)C(F)F)ccc2F)N=C(N)C(C)(C)S1(=O)=O |
| InChI | InChI=1S/C16H23F3N4O3S/c1-15(2)14(20)22-16(3,8-23(4)27(15,25)26)10-7-9(5-6-11(10)17)21-13(24)12(18)19/h5-7,12-13,21,24H,8H2,1-4H3,(H2,20,22)/t13?,16-/m0/s1 |
| InChIKey | FGPYJOUQMCVFDS-VYIIXAMBSA-N |
| XLogP | 1.45 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|