C15H22BrN3O2S — CID 118191797
(4R)-4-(5-bromo-2-methylphenyl)-2,4,7,7-tetramethyl-1,1-dioxo-3H-1,2,5-thiadiazepin-6-amine (PubChem CID 118191797) has the molecular formula C15H22BrN3O2S and a molecular weight of 388.33 g/mol. Its IUPAC name is (4R)-4-(5-bromo-2-methylphenyl)-2,4,7,7-tetramethyl-1,1-dioxo-3H-1,2,5-thiadiazepin-6-amine.
| Compound Name | (4R)-4-(5-bromo-2-methylphenyl)-2,4,7,7-tetramethyl-1,1-dioxo-3H-1,2,5-thiadiazepin-6-amine |
|---|---|
| PubChem CID | 118191797 |
| Molecular Formula | C15H22BrN3O2S |
| Molecular Weight | 388.33 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | (4R)-4-(5-bromo-2-methylphenyl)-2,4,7,7-tetramethyl-1,1-dioxo-3H-1,2,5-thiadiazepin-6-amine |
| SMILES | Cc1ccc(Br)cc1[C@]1(C)CN(C)S(=O)(=O)C(C)(C)C(N)=N1 |
| InChI | InChI=1S/C15H22BrN3O2S/c1-10-6-7-11(16)8-12(10)15(4)9-19(5)22(20,21)14(2,3)13(17)18-15/h6-8H,9H2,1-5H3,(H2,17,18)/t15-/m0/s1 |
| InChIKey | TZDNRARYOYEYCV-HNNXBMFYSA-N |
| XLogP | 2.38 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |