C18H24BrN3 — CID 126629493
2-(5-bromo-2-methylphenyl)-5-methyl-2-(1-methylcyclohexyl)imidazol-4-amine (PubChem CID 126629493) has the molecular formula C18H24BrN3 and a molecular weight of 362.32 g/mol. Its IUPAC name is 2-(5-bromo-2-methylphenyl)-5-methyl-2-(1-methylcyclohexyl)imidazol-4-amine.
| Compound Name | 2-(5-bromo-2-methylphenyl)-5-methyl-2-(1-methylcyclohexyl)imidazol-4-amine |
|---|---|
| PubChem CID | 126629493 |
| Molecular Formula | C18H24BrN3 |
| Molecular Weight | 362.32 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 2-(5-bromo-2-methylphenyl)-5-methyl-2-(1-methylcyclohexyl)imidazol-4-amine |
| SMILES | CC1=NC(c2cc(Br)ccc2C)(C2(C)CCCCC2)N=C1N |
| InChI | InChI=1S/C18H24BrN3/c1-12-7-8-14(19)11-15(12)18(21-13(2)16(20)22-18)17(3)9-5-4-6-10-17/h7-8,11H,4-6,9-10H2,1-3H3,(H2,20,22) |
| InChIKey | ZVCHSKKLCXWDGI-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.32 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |