About 6-bromo-5'-methylspiro[2,3-dihydro-1H-naphthalene-4,2'-imidazole]-4'-amine
6-bromo-5'-methylspiro[2,3-dihydro-1H-naphthalene-4,2'-imidazole]-4'-amine (PubChem CID 57386415) has the molecular formula C13H14BrN3
and a molecular weight of 292.18 g/mol. Its IUPAC name is 6-bromo-5'-methylspiro[2,3-dihydro-1H-naphthalene-4,2'-imidazole]-4'-amine.
Molecular Properties
| Compound Name | 6-bromo-5'-methylspiro[2,3-dihydro-1H-naphthalene-4,2'-imidazole]-4'-amine |
| PubChem CID | 57386415 |
| Molecular Formula | C13H14BrN3 |
| Molecular Weight | 292.18 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 6-bromo-5'-methylspiro[2,3-dihydro-1H-naphthalene-4,2'-imidazole]-4'-amine |
| SMILES | CC1=NC2(CCCc3ccc(Br)cc32)N=C1N |
| InChI | InChI=1S/C13H14BrN3/c1-8-12(15)17-13(16-8)6-2-3-9-4-5-10(14)7-11(9)13/h4-5,7H,2-3,6H2,1H3,(H2,15,17) |
| InChIKey | QNHHDQXBRHSEHK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.18 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-5'-methylspiro[2,3-dihydro-1H-naphthalene-4,2'-imidazole]-4'-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-5'-methylspiro[2,3-dihydro-1H-naphthalene-4,2'-imidazole]-4'-amine?
The IUPAC name of 6-bromo-5'-methylspiro[2,3-dihydro-1H-naphthalene-4,2'-imidazole]-4'-amine (CID 57386415) is 6-bromo-5'-methylspiro[2,3-dihydro-1H-naphthalene-4,2'-imidazole]-4'-amine.
What is the SMILES notation for 6-bromo-5'-methylspiro[2,3-dihydro-1H-naphthalene-4,2'-imidazole]-4'-amine?
The canonical SMILES for 6-bromo-5'-methylspiro[2,3-dihydro-1H-naphthalene-4,2'-imidazole]-4'-amine is CC1=NC2(CCCc3ccc(Br)cc32)N=C1N.
What is the InChIKey of 6-bromo-5'-methylspiro[2,3-dihydro-1H-naphthalene-4,2'-imidazole]-4'-amine?
The InChIKey is QNHHDQXBRHSEHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14BrN3/c1-8-12(15)17-13(16-8)6-2-3-9-4-5-10(14)7-11(9)13/h4-5,7H,2-3,6H2,1H3,(H2,15,17).
What are the key properties of 6-bromo-5'-methylspiro[2,3-dihydro-1H-naphthalene-4,2'-imidazole]-4'-amine?
6-bromo-5'-methylspiro[2,3-dihydro-1H-naphthalene-4,2'-imidazole]-4'-amine has a molecular weight of 292.18 g/mol, XLogP of 2.77, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-5'-methylspiro[2,3-dihydro-1H-naphthalene-4,2'-imidazole]-4'-amine is sourced from PubChem (CID 57386415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).