C16H16BrNO — CID 18960980
2-(7-bromo-1-methoxy-3,4-dihydro-2H-naphthalen-1-yl)pyridine (PubChem CID 18960980) has the molecular formula C16H16BrNO and a molecular weight of 318.21 g/mol. Its IUPAC name is 2-(7-bromo-1-methoxy-3,4-dihydro-2H-naphthalen-1-yl)pyridine.
| Compound Name | 2-(7-bromo-1-methoxy-3,4-dihydro-2H-naphthalen-1-yl)pyridine |
|---|---|
| PubChem CID | 18960980 |
| Molecular Formula | C16H16BrNO |
| Molecular Weight | 318.21 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 2-(7-bromo-1-methoxy-3,4-dihydro-2H-naphthalen-1-yl)pyridine |
| SMILES | COC1(c2ccccn2)CCCc2ccc(Br)cc21 |
| InChI | InChI=1S/C16H16BrNO/c1-19-16(15-6-2-3-10-18-15)9-4-5-12-7-8-13(17)11-14(12)16/h2-3,6-8,10-11H,4-5,9H2,1H3 |
| InChIKey | BZOCAVTYXFZRJD-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.21 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |