C24H27BrINOS — CID 163454523
17'-bromo-3,6-dimethyl-2-methylsulfanylspiro[1λ3-ioda-3-azacyclohexene-5,2'-tricyclo[12.4.0.05,10]octadeca-1(14),5,7,9,15,17-hexaene]-4-one (PubChem CID 163454523) has the molecular formula C24H27BrINOS and a molecular weight of 584.36 g/mol. Its IUPAC name is 17'-bromo-3,6-dimethyl-2-methylsulfanylspiro[1λ3-ioda-3-azacyclohexene-5,2'-tricyclo[12.4.0.05,10]octadeca-1(14),5,7,9,15,17-hexaene]-4-one.
| Compound Name | 17'-bromo-3,6-dimethyl-2-methylsulfanylspiro[1λ3-ioda-3-azacyclohexene-5,2'-tricyclo[12.4.0.05,10]octadeca-1(14),5,7,9,15,17-hexaene]-4-one |
|---|---|
| PubChem CID | 163454523 |
| Molecular Formula | C24H27BrINOS |
| Molecular Weight | 584.36 g/mol |
| Exact Mass | 583.00 |
| IUPAC Name | 17'-bromo-3,6-dimethyl-2-methylsulfanylspiro[1λ3-ioda-3-azacyclohexene-5,2'-tricyclo[12.4.0.05,10]octadeca-1(14),5,7,9,15,17-hexaene]-4-one |
| SMILES | CSC1=IC(C)C2(CCc3ccccc3CCCc3ccc(Br)cc32)C(=O)N1C |
| InChI | InChI=1S/C24H27BrINOS/c1-16-24(22(28)27(2)23(26-16)29-3)14-13-18-8-5-4-7-17(18)9-6-10-19-11-12-20(25)15-21(19)24/h4-5,7-8,11-12,15-16H,6,9-10,13-14H2,1-3H3 |
| InChIKey | BJHSEOQYCYGQPO-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.36 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|