C18H22N2O2 — CID 70358632
1'-methyl-4'-piperidin-1-ylspiro[1,2-dihydroindene-3,3'-pyrrolidine]-2',5'-dione (PubChem CID 70358632) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 1'-methyl-4'-piperidin-1-ylspiro[1,2-dihydroindene-3,3'-pyrrolidine]-2',5'-dione.
| Compound Name | 1'-methyl-4'-piperidin-1-ylspiro[1,2-dihydroindene-3,3'-pyrrolidine]-2',5'-dione |
|---|---|
| PubChem CID | 70358632 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 1'-methyl-4'-piperidin-1-ylspiro[1,2-dihydroindene-3,3'-pyrrolidine]-2',5'-dione |
| SMILES | CN1C(=O)C(N2CCCCC2)C2(CCc3ccccc32)C1=O |
| InChI | InChI=1S/C18H22N2O2/c1-19-16(21)15(20-11-5-2-6-12-20)18(17(19)22)10-9-13-7-3-4-8-14(13)18/h3-4,7-8,15H,2,5-6,9-12H2,1H3 |
| InChIKey | WAPGNRMBFZBGPJ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|