C21H17BrN2O — CID 135032610
(3S)-3-anilino-5-bromo-1-methyl-3-phenylindol-2-one (PubChem CID 135032610) has the molecular formula C21H17BrN2O and a molecular weight of 393.28 g/mol. Its IUPAC name is (3S)-3-anilino-5-bromo-1-methyl-3-phenylindol-2-one.
| Compound Name | (3S)-3-anilino-5-bromo-1-methyl-3-phenylindol-2-one |
|---|---|
| PubChem CID | 135032610 |
| Molecular Formula | C21H17BrN2O |
| Molecular Weight | 393.28 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | (3S)-3-anilino-5-bromo-1-methyl-3-phenylindol-2-one |
| SMILES | CN1C(=O)[C@](Nc2ccccc2)(c2ccccc2)c2cc(Br)ccc21 |
| InChI | InChI=1S/C21H17BrN2O/c1-24-19-13-12-16(22)14-18(19)21(20(24)25,15-8-4-2-5-9-15)23-17-10-6-3-7-11-17/h2-14,23H,1H3/t21-/m0/s1 |
| InChIKey | OJPUPZZLFDTAHI-NRFANRHFSA-N |
| XLogP | 4.78 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.28 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |