C23H24BrN3O3 — CID 102451334
tert-butyl N-[(3S)-5-bromo-1-methyl-3-(1-methylindol-3-yl)-2-oxoindol-3-yl]carbamate (PubChem CID 102451334) has the molecular formula C23H24BrN3O3 and a molecular weight of 470.37 g/mol. Its IUPAC name is tert-butyl N-[(3S)-5-bromo-1-methyl-3-(1-methylindol-3-yl)-2-oxoindol-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-5-bromo-1-methyl-3-(1-methylindol-3-yl)-2-oxoindol-3-yl]carbamate |
|---|---|
| PubChem CID | 102451334 |
| Molecular Formula | C23H24BrN3O3 |
| Molecular Weight | 470.37 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | tert-butyl N-[(3S)-5-bromo-1-methyl-3-(1-methylindol-3-yl)-2-oxoindol-3-yl]carbamate |
| SMILES | CN1C(=O)[C@](NC(=O)OC(C)(C)C)(c2cn(C)c3ccccc23)c2cc(Br)ccc21 |
| InChI | InChI=1S/C23H24BrN3O3/c1-22(2,3)30-21(29)25-23(17-13-26(4)18-9-7-6-8-15(17)18)16-12-14(24)10-11-19(16)27(5)20(23)28/h6-13H,1-5H3,(H,25,29)/t23-/m1/s1 |
| InChIKey | CBOONMNJLNLQGV-HSZRJFAPSA-N |
| XLogP | 4.69 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.37 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |