C20H18BrNO3S — CID 90467840
methyl 2-(3-benzylsulfanyl-5-bromo-1-methyl-2-oxoindol-3-yl)prop-2-enoate (PubChem CID 90467840) has the molecular formula C20H18BrNO3S and a molecular weight of 432.34 g/mol. Its IUPAC name is methyl 2-(3-benzylsulfanyl-5-bromo-1-methyl-2-oxoindol-3-yl)prop-2-enoate.
| Compound Name | methyl 2-(3-benzylsulfanyl-5-bromo-1-methyl-2-oxoindol-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 90467840 |
| Molecular Formula | C20H18BrNO3S |
| Molecular Weight | 432.34 g/mol |
| Exact Mass | 431.02 |
| IUPAC Name | methyl 2-(3-benzylsulfanyl-5-bromo-1-methyl-2-oxoindol-3-yl)prop-2-enoate |
| SMILES | C=C(C(=O)OC)C1(SCc2ccccc2)C(=O)N(C)c2ccc(Br)cc21 |
| InChI | InChI=1S/C20H18BrNO3S/c1-13(18(23)25-3)20(26-12-14-7-5-4-6-8-14)16-11-15(21)9-10-17(16)22(2)19(20)24/h4-11H,1,12H2,2-3H3 |
| InChIKey | IBVNLUMPYUVXLV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.34 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|