C20H19FO2 — CID 89475205
(7-fluoro-1-phenyl-3,4-dihydro-2H-naphthalen-1-yl) 2-methylprop-2-enoate (PubChem CID 89475205) has the molecular formula C20H19FO2 and a molecular weight of 310.37 g/mol. Its IUPAC name is (7-fluoro-1-phenyl-3,4-dihydro-2H-naphthalen-1-yl) 2-methylprop-2-enoate.
| Compound Name | (7-fluoro-1-phenyl-3,4-dihydro-2H-naphthalen-1-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89475205 |
| Molecular Formula | C20H19FO2 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (7-fluoro-1-phenyl-3,4-dihydro-2H-naphthalen-1-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(c2ccccc2)CCCc2ccc(F)cc21 |
| InChI | InChI=1S/C20H19FO2/c1-14(2)19(22)23-20(16-8-4-3-5-9-16)12-6-7-15-10-11-17(21)13-18(15)20/h3-5,8-11,13H,1,6-7,12H2,2H3 |
| InChIKey | YXXWHPQQACXPHF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|