C18H20O2 — CID 58341803
(5-prop-2-ynyl-6,7,8,9-tetrahydrobenzo[7]annulen-5-yl) 2-methylprop-2-enoate (PubChem CID 58341803) has the molecular formula C18H20O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is (5-prop-2-ynyl-6,7,8,9-tetrahydrobenzo[7]annulen-5-yl) 2-methylprop-2-enoate.
| Compound Name | (5-prop-2-ynyl-6,7,8,9-tetrahydrobenzo[7]annulen-5-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58341803 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | (5-prop-2-ynyl-6,7,8,9-tetrahydrobenzo[7]annulen-5-yl) 2-methylprop-2-enoate |
| SMILES | C#CCC1(OC(=O)C(=C)C)CCCCc2ccccc21 |
| InChI | InChI=1S/C18H20O2/c1-4-12-18(20-17(19)14(2)3)13-8-7-10-15-9-5-6-11-16(15)18/h1,5-6,9,11H,2,7-8,10,12-13H2,3H3 |
| InChIKey | RXHKQSKZNOWEQP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|