C19H24O2 — CID 58341767
spiro[7,8,9,10-tetrahydro-5H-benzo[8]annulene-6,1'-cyclobutane]-5-yl 2-methylprop-2-enoate (PubChem CID 58341767) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is spiro[7,8,9,10-tetrahydro-5H-benzo[8]annulene-6,1'-cyclobutane]-5-yl 2-methylprop-2-enoate.
| Compound Name | spiro[7,8,9,10-tetrahydro-5H-benzo[8]annulene-6,1'-cyclobutane]-5-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58341767 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | spiro[7,8,9,10-tetrahydro-5H-benzo[8]annulene-6,1'-cyclobutane]-5-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1c2ccccc2CCCCC12CCC2 |
| InChI | InChI=1S/C19H24O2/c1-14(2)18(20)21-17-16-10-4-3-8-15(16)9-5-6-11-19(17)12-7-13-19/h3-4,8,10,17H,1,5-7,9,11-13H2,2H3 |
| InChIKey | SJGMCEFPRDWLFC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|