C16H20O2 — CID 89397792
(6-methyl-5,7,8,9-tetrahydrobenzo[7]annulen-6-yl) 2-methylprop-2-enoate (PubChem CID 89397792) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is (6-methyl-5,7,8,9-tetrahydrobenzo[7]annulen-6-yl) 2-methylprop-2-enoate.
| Compound Name | (6-methyl-5,7,8,9-tetrahydrobenzo[7]annulen-6-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89397792 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | (6-methyl-5,7,8,9-tetrahydrobenzo[7]annulen-6-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(C)CCCc2ccccc2C1 |
| InChI | InChI=1S/C16H20O2/c1-12(2)15(17)18-16(3)10-6-9-13-7-4-5-8-14(13)11-16/h4-5,7-8H,1,6,9-11H2,2-3H3 |
| InChIKey | DJXUPAXCXJWPFG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|