About (4-methyl-1-phenacylthian-1-ium-4-yl) 2-methylprop-2-enoate bromide
(4-methyl-1-phenacylthian-1-ium-4-yl) 2-methylprop-2-enoate bromide (PubChem CID 161170213) has the molecular formula C18H23BrO3S
and a molecular weight of 399.35 g/mol. Its IUPAC name is (4-methyl-1-phenacylthian-1-ium-4-yl) 2-methylprop-2-enoate bromide.
Molecular Properties
| Compound Name | (4-methyl-1-phenacylthian-1-ium-4-yl) 2-methylprop-2-enoate bromide |
| PubChem CID | 161170213 |
| Molecular Formula | C18H23BrO3S |
| Molecular Weight | 399.35 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | (4-methyl-1-phenacylthian-1-ium-4-yl) 2-methylprop-2-enoate bromide |
| SMILES | C=C(C)C(=O)OC1(C)CC[S+](CC(=O)c2ccccc2)CC1.[Br-] |
| InChI | InChI=1S/C18H23O3S.BrH/c1-14(2)17(20)21-18(3)9-11-22(12-10-18)13-16(19)15-7-5-4-6-8-15;/h4-8H,1,9-13H2,2-3H3;1H/q+1;/p-1 |
| InChIKey | XNTVJVDFGRATDE-UHFFFAOYSA-M |
| XLogP | 0.16 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.35 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (4-methyl-1-phenacylthian-1-ium-4-yl) 2-methylprop-2-enoate bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyl-1-phenacylthian-1-ium-4-yl) 2-methylprop-2-enoate bromide?
The IUPAC name of (4-methyl-1-phenacylthian-1-ium-4-yl) 2-methylprop-2-enoate bromide (CID 161170213) is (4-methyl-1-phenacylthian-1-ium-4-yl) 2-methylprop-2-enoate bromide.
What is the SMILES notation for (4-methyl-1-phenacylthian-1-ium-4-yl) 2-methylprop-2-enoate bromide?
The canonical SMILES for (4-methyl-1-phenacylthian-1-ium-4-yl) 2-methylprop-2-enoate bromide is C=C(C)C(=O)OC1(C)CC[S+](CC(=O)c2ccccc2)CC1.[Br-].
What is the InChIKey of (4-methyl-1-phenacylthian-1-ium-4-yl) 2-methylprop-2-enoate bromide?
The InChIKey is XNTVJVDFGRATDE-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H23O3S.BrH/c1-14(2)17(20)21-18(3)9-11-22(12-10-18)13-16(19)15-7-5-4-6-8-15;/h4-8H,1,9-13H2,2-3H3;1H/q+1;/p-1.
What are the key properties of (4-methyl-1-phenacylthian-1-ium-4-yl) 2-methylprop-2-enoate bromide?
(4-methyl-1-phenacylthian-1-ium-4-yl) 2-methylprop-2-enoate bromide has a molecular weight of 399.35 g/mol, XLogP of 0.16, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-1-phenacylthian-1-ium-4-yl) 2-methylprop-2-enoate bromide is sourced from PubChem (CID 161170213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).