C19H24O4 — CID 23579806
2-(1-benzoylcyclohexyl)oxyethyl 2-methylprop-2-enoate (PubChem CID 23579806) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is 2-(1-benzoylcyclohexyl)oxyethyl 2-methylprop-2-enoate.
| Compound Name | 2-(1-benzoylcyclohexyl)oxyethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 23579806 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 2-(1-benzoylcyclohexyl)oxyethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC1(C(=O)c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C19H24O4/c1-15(2)18(21)22-13-14-23-19(11-7-4-8-12-19)17(20)16-9-5-3-6-10-16/h3,5-6,9-10H,1,4,7-8,11-14H2,2H3 |
| InChIKey | HNCAKXOXEYIERP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|