C17H22O2 — CID 89397821
(2-butyl-1,3-dihydroinden-2-yl) 2-methylprop-2-enoate (PubChem CID 89397821) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is (2-butyl-1,3-dihydroinden-2-yl) 2-methylprop-2-enoate.
| Compound Name | (2-butyl-1,3-dihydroinden-2-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89397821 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | (2-butyl-1,3-dihydroinden-2-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(CCCC)Cc2ccccc2C1 |
| InChI | InChI=1S/C17H22O2/c1-4-5-10-17(19-16(18)13(2)3)11-14-8-6-7-9-15(14)12-17/h6-9H,2,4-5,10-12H2,1,3H3 |
| InChIKey | YENNBANALIFXGE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|