C20H20O2S — CID 59476823
[9-(3-sulfanylpropyl)fluoren-9-yl] 2-methylprop-2-enoate (PubChem CID 59476823) has the molecular formula C20H20O2S and a molecular weight of 324.45 g/mol. Its IUPAC name is [9-(3-sulfanylpropyl)fluoren-9-yl] 2-methylprop-2-enoate.
| Compound Name | [9-(3-sulfanylpropyl)fluoren-9-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59476823 |
| Molecular Formula | C20H20O2S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | [9-(3-sulfanylpropyl)fluoren-9-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(CCCS)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C20H20O2S/c1-14(2)19(21)22-20(12-7-13-23)17-10-5-3-8-15(17)16-9-4-6-11-18(16)20/h3-6,8-11,23H,1,7,12-13H2,2H3 |
| InChIKey | MYIQDVHNLBMYSX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|