C23H21NO4 — CID 160961559
(7-methylbenzo[a]phenalen-7-yl) 2-methylprop-2-enoate;nitromethane (PubChem CID 160961559) has the molecular formula C23H21NO4 and a molecular weight of 375.42 g/mol. Its IUPAC name is (7-methylbenzo[a]phenalen-7-yl) 2-methylprop-2-enoate;nitromethane.
| Compound Name | (7-methylbenzo[a]phenalen-7-yl) 2-methylprop-2-enoate;nitromethane |
|---|---|
| PubChem CID | 160961559 |
| Molecular Formula | C23H21NO4 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | (7-methylbenzo[a]phenalen-7-yl) 2-methylprop-2-enoate;nitromethane |
| SMILES | C=C(C)C(=O)OC1(C)c2ccccc2-c2cccc3cccc1c23.C[N+](=O)[O-] |
| InChI | InChI=1S/C22H18O2.CH3NO2/c1-14(2)21(23)24-22(3)18-12-5-4-10-16(18)17-11-6-8-15-9-7-13-19(22)20(15)17;1-2(3)4/h4-13H,1H2,2-3H3;1H3 |
| InChIKey | SXBOYWUVJYAOGO-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|