C23H16O2 — CID 59476795
(11-ethynylbenzo[b]fluoren-11-yl) 2-methylprop-2-enoate (PubChem CID 59476795) has the molecular formula C23H16O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is (11-ethynylbenzo[b]fluoren-11-yl) 2-methylprop-2-enoate.
| Compound Name | (11-ethynylbenzo[b]fluoren-11-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59476795 |
| Molecular Formula | C23H16O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | (11-ethynylbenzo[b]fluoren-11-yl) 2-methylprop-2-enoate |
| SMILES | C#CC1(OC(=O)C(=C)C)c2ccccc2-c2cc3ccccc3cc21 |
| InChI | InChI=1S/C23H16O2/c1-4-23(25-22(24)15(2)3)20-12-8-7-11-18(20)19-13-16-9-5-6-10-17(16)14-21(19)23/h1,5-14H,2H2,3H3 |
| InChIKey | VUIGMFJPHKBTIT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|