C22H22O2 — CID 129105713
[(2E,3Z)-2,3-di(ethylidene)-1-methylphenalen-1-yl] 2-methylprop-2-enoate (PubChem CID 129105713) has the molecular formula C22H22O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is [(2E,3Z)-2,3-di(ethylidene)-1-methylphenalen-1-yl] 2-methylprop-2-enoate.
| Compound Name | [(2E,3Z)-2,3-di(ethylidene)-1-methylphenalen-1-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 129105713 |
| Molecular Formula | C22H22O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | [(2E,3Z)-2,3-di(ethylidene)-1-methylphenalen-1-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(C)C(=C/C)/C(=C\C)c2cccc3cccc1c23 |
| InChI | InChI=1S/C22H22O2/c1-6-16-17-12-8-10-15-11-9-13-19(20(15)17)22(5,18(16)7-2)24-21(23)14(3)4/h6-13H,3H2,1-2,4-5H3/b16-6-,18-7+ |
| InChIKey | DBWVTOILKIGRHN-FAKNLOEVSA-N |
| XLogP | 5.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|