C17H21N3 — CID 141388602
CID 141388602 (PubChem CID 141388602) has the molecular formula C17H21N3 and a molecular weight of 267.38 g/mol.
| Compound Name | CID 141388602 |
|---|---|
| PubChem CID | 141388602 |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | — |
| SMILES | CC1=NC2(N=C1N)c1ccccc1CC21CCCCC1 |
| InChI | InChI=1S/C17H21N3/c1-12-15(18)20-17(19-12)14-8-4-3-7-13(14)11-16(17)9-5-2-6-10-16/h3-4,7-8H,2,5-6,9-11H2,1H3,(H2,18,20) |
| InChIKey | CXPJIRUWOBPUQS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |