C19H25N3O — CID 140728952
CID 140728952 (PubChem CID 140728952) has the molecular formula C19H25N3O and a molecular weight of 311.43 g/mol.
| Compound Name | CID 140728952 |
|---|---|
| PubChem CID | 140728952 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | — |
| SMILES | CCOC1CCCCC12Cc1ccccc1C21N=C(C)C(N)=N1 |
| InChI | InChI=1S/C19H25N3O/c1-3-23-16-10-6-7-11-18(16)12-14-8-4-5-9-15(14)19(18)21-13(2)17(20)22-19/h4-5,8-9,16H,3,6-7,10-12H2,1-2H3,(H2,20,22) |
| InChIKey | LTDZMHZQZZYSEG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |