About CID 118375104
CID 118375104 (PubChem CID 118375104) has the molecular formula C22H28N4O
and a molecular weight of 364.49 g/mol.
Molecular Properties
| Compound Name | CID 118375104 |
| PubChem CID | 118375104 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | — |
| SMILES | CC[C@@H]1C[C@@]2(Cc3ccc(C#N)cc3[C@@]23N=C(C)C(N)=N3)C[C@H](C)[C@H]1OC |
| InChI | InChI=1S/C22H28N4O/c1-5-16-10-21(9-13(2)19(16)27-4)11-17-7-6-15(12-23)8-18(17)22(21)25-14(3)20(24)26-22/h6-8,13,16,19H,5,9-11H2,1-4H3,(H2,24,26)/t13-,16+,19+,21+,22-/m0/s1 |
| InChIKey | SPWWHXFJDGMBGE-FMYRJKCHSA-N |
| XLogP | 3.56 |
| TPSA | 83.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 118375104 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 118375104?
The IUPAC name of CID 118375104 (CID 118375104) is not available.
What is the SMILES notation for CID 118375104?
The canonical SMILES for CID 118375104 is CC[C@@H]1C[C@@]2(Cc3ccc(C#N)cc3[C@@]23N=C(C)C(N)=N3)C[C@H](C)[C@H]1OC.
What is the InChIKey of CID 118375104?
The InChIKey is SPWWHXFJDGMBGE-FMYRJKCHSA-N. The full InChI is InChI=1S/C22H28N4O/c1-5-16-10-21(9-13(2)19(16)27-4)11-17-7-6-15(12-23)8-18(17)22(21)25-14(3)20(24)26-22/h6-8,13,16,19H,5,9-11H2,1-4H3,(H2,24,26)/t13-,16+,19+,21+,22-/m0/s1.
What are the key properties of CID 118375104?
CID 118375104 has a molecular weight of 364.49 g/mol, XLogP of 3.56, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 118375104 is sourced from PubChem (CID 118375104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).