C24H25F2N3O — CID 67979593
CID 67979593 (PubChem CID 67979593) has the molecular formula C24H25F2N3O and a molecular weight of 409.48 g/mol.
| Compound Name | CID 67979593 |
|---|---|
| PubChem CID | 67979593 |
| Molecular Formula | C24H25F2N3O |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | — |
| SMILES | COC1CCC2(CC1)Cc1ccc(-c3cc(F)cc(F)c3)cc1[C@@]21N=C(C)C(N)=N1 |
| InChI | InChI=1S/C24H25F2N3O/c1-14-22(27)29-24(28-14)21-11-15(17-9-18(25)12-19(26)10-17)3-4-16(21)13-23(24)7-5-20(30-2)6-8-23/h3-4,9-12,20H,5-8,13H2,1-2H3,(H2,27,29)/t20?,23?,24-/m0/s1 |
| InChIKey | HRDQJFPXQGWLSV-BOYUCYPVSA-N |
| XLogP | 4.75 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |