About CID 159452395
CID 159452395 (PubChem CID 159452395) has the molecular formula C30H29ClFN3O
and a molecular weight of 502.03 g/mol.
Molecular Properties
| Compound Name | CID 159452395 |
| PubChem CID | 159452395 |
| Molecular Formula | C30H29ClFN3O |
| Molecular Weight | 502.03 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | — |
| SMILES | C.COC1CCC2(CC1)Cc1ccc(-c3cc(F)cc(Cl)c3)cc1C21N=C(N)c2ccc(C#N)cc21 |
| InChI | InChI=1S/C29H25ClFN3O.CH4/c1-35-23-6-8-28(9-7-23)15-19-4-3-18(20-11-21(30)14-22(31)12-20)13-25(19)29(28)26-10-17(16-32)2-5-24(26)27(33)34-29;/h2-5,10-14,23H,6-9,15H2,1H3,(H2,33,34);1H4 |
| InChIKey | LTNUZPUTEUMXKH-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 71.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 502.03 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 159452395 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159452395?
The IUPAC name of CID 159452395 (CID 159452395) is not available.
What is the SMILES notation for CID 159452395?
The canonical SMILES for CID 159452395 is C.COC1CCC2(CC1)Cc1ccc(-c3cc(F)cc(Cl)c3)cc1C21N=C(N)c2ccc(C#N)cc21.
What is the InChIKey of CID 159452395?
The InChIKey is LTNUZPUTEUMXKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H25ClFN3O.CH4/c1-35-23-6-8-28(9-7-23)15-19-4-3-18(20-11-21(30)14-22(31)12-20)13-25(19)29(28)26-10-17(16-32)2-5-24(26)27(33)34-29;/h2-5,10-14,23H,6-9,15H2,1H3,(H2,33,34);1H4.
What are the key properties of CID 159452395?
CID 159452395 has a molecular weight of 502.03 g/mol, XLogP of 6.75, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159452395 is sourced from PubChem (CID 159452395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).