C25H27FN4O2 — CID 147085200
CID 147085200 (PubChem CID 147085200) has the molecular formula C25H27FN4O2 and a molecular weight of 434.52 g/mol.
| Compound Name | CID 147085200 |
|---|---|
| PubChem CID | 147085200 |
| Molecular Formula | C25H27FN4O2 |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | — |
| SMILES | COC1CCC2(CC1)Cc1ccc(CC(=O)c3ccc(F)cn3)cc1C21N=C(C)C(N)=N1 |
| InChI | InChI=1S/C25H27FN4O2/c1-15-23(27)30-25(29-15)20-11-16(12-22(31)21-6-5-18(26)14-28-21)3-4-17(20)13-24(25)9-7-19(32-2)8-10-24/h3-6,11,14,19H,7-10,12-13H2,1-2H3,(H2,27,30) |
| InChIKey | BHRUKMQHVRQODO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |