C26H27F3N4O2 — CID 149210100
CID 149210100 (PubChem CID 149210100) has the molecular formula C26H27F3N4O2 and a molecular weight of 484.52 g/mol.
| Compound Name | CID 149210100 |
|---|---|
| PubChem CID | 149210100 |
| Molecular Formula | C26H27F3N4O2 |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | — |
| SMILES | COC1CCC2(CC1)Cc1ccc(CC(=O)c3ccc(C(F)(F)F)cn3)cc1C21N=C(C)C(N)=N1 |
| InChI | InChI=1S/C26H27F3N4O2/c1-15-23(30)33-25(32-15)20-11-16(12-22(34)21-6-5-18(14-31-21)26(27,28)29)3-4-17(20)13-24(25)9-7-19(35-2)8-10-24/h3-6,11,14,19H,7-10,12-13H2,1-2H3,(H2,30,33) |
| InChIKey | XGKJJSGXWIMYBX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |