C28H34N4O — CID 158314859
CID 158314859 (PubChem CID 158314859) has the molecular formula C28H34N4O and a molecular weight of 442.61 g/mol.
| Compound Name | CID 158314859 |
|---|---|
| PubChem CID | 158314859 |
| Molecular Formula | C28H34N4O |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | — |
| SMILES | C.CC#Cc1cncc(-c2ccc3c(c2)C2(N=C(N)C(CC)=N2)C2(CCC(OC)CC2)C3)c1 |
| InChI | InChI=1S/C27H30N4O.CH4/c1-4-6-18-13-21(17-29-16-18)19-7-8-20-15-26(11-9-22(32-3)10-12-26)27(23(20)14-19)30-24(5-2)25(28)31-27;/h7-8,13-14,16-17,22H,5,9-12,15H2,1-3H3,(H2,28,31);1H4 |
| InChIKey | GODFXWWOCKGKDK-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|